CAS 2166-14-5 appears in our catalog under these names: Dimethyl 1,2,4,5-tetrazine-3,6-dicarboxylate 95%, 3,6-BIS(METHOXYCARBONYL)-1,2,4,5-TETRAZI, Dimethyl 1,2,4,5-tetrazine-3,6-dicarboxylate, 97%, 97%, Dimethyl 1,2,4,5-tetrazine-3,6-dicarboxylate, 97%. Offered by: Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 15g, 25g.
Dimethyl 1,2,4,5-tetrazine-3,6-dicarboxylate (CAS 2166-14-5) is a chemical compound with the molecular formula C6H6N4O4 and a molecular weight of 198.14 g/mol. IUPAC name: dimethyl 1,2,4,5-tetrazine-3,6-dicarboxylate. InChIKey: QODPSGGFQFBWME-UHFFFAOYSA-N.
| Molecular formula | C6H6N4O4 |
|---|---|
| Molecular weight | 198.14 g/mol |
| IUPAC name | dimethyl 1,2,4,5-tetrazine-3,6-dicarboxylate |
| InChIKey | QODPSGGFQFBWME-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NN=C(N=N1)C(=O)OC |
Computed by PubChem (NCBI)