CAS 4987-96-6 appears in our catalog under these names: 4,6–Dinitro–1,3–benzenediamine, 4,6-Dinitrobenzene-1,3-diamine, 4,6-Dinitro-1,3-benzenediamine, 95%, 95%, 4,6-Dinitrobenzene-1,3-diamine, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 2,5g, 100mg, 10g.
4,6-dinitrobenzene-1,3-diamine (CAS 4987-96-6) is a chemical compound with the molecular formula C6H6N4O4 and a molecular weight of 198.14 g/mol. IUPAC name: 4,6-dinitrobenzene-1,3-diamine. InChIKey: DFBUFGZWPXQRJV-UHFFFAOYSA-N.
| Molecular formula | C6H6N4O4 |
|---|---|
| Molecular weight | 198.14 g/mol |
| IUPAC name | 4,6-dinitrobenzene-1,3-diamine |
| InChIKey | DFBUFGZWPXQRJV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1N)[N+](=O)[O-])[N+](=O)[O-])N |
Computed by PubChem (NCBI)