CAS 3694-51-7 appears in our catalog under these names: 2-Amino-3,5-dinitrophenylamine, 95%, 3,5-Dinitro-1,2-phenylenediamine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 10g, 5g, 2g.
3,5-dinitrobenzene-1,2-diamine (CAS 3694-51-7) is a chemical compound with the molecular formula C6H6N4O4 and a molecular weight of 198.14 g/mol. IUPAC name: 3,5-dinitrobenzene-1,2-diamine. InChIKey: JMGGTZMFWKWZSJ-UHFFFAOYSA-N.
| Molecular formula | C6H6N4O4 |
|---|---|
| Molecular weight | 198.14 g/mol |
| IUPAC name | 3,5-dinitrobenzene-1,2-diamine |
| InChIKey | JMGGTZMFWKWZSJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1N)N)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)