CAS 32690-28-1 appears in our catalog under these names: 4,5–Dinitrobenzene–1,2–diamine, 4,5-Dinitrobenzene-1,2-diamine 95%, 4,5-Dinitrobenzene-1,2-Diamine, 95%, 95%, 4,5-Dinitrobenzene-1,2-diamine, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4,5-dinitrobenzene-1,2-diamine (CAS 32690-28-1) is a chemical compound with the molecular formula C6H6N4O4 and a molecular weight of 198.14 g/mol. IUPAC name: 4,5-dinitrobenzene-1,2-diamine. InChIKey: PCSIZKSNIWJKSK-UHFFFAOYSA-N.
| Molecular formula | C6H6N4O4 |
|---|---|
| Molecular weight | 198.14 g/mol |
| IUPAC name | 4,5-dinitrobenzene-1,2-diamine |
| InChIKey | PCSIZKSNIWJKSK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])[N+](=O)[O-])N)N |
Computed by PubChem (NCBI)