CAS 1217220-85-3 appears in our catalog under these names: Nitrofurazone-13C-15N2, Nitrofurazone-13C,15N2, Nitrofurazone 13C,15N2 100 µg/mL in Acetonitrile, Nitrofurazone–13C,15N2, Nitrofurazone-¹³C,¹âµN2. Offered by: Hubei YoungXin, TRC, Dr. Ehrenstorfer, GLPBio, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1ml, 1mg, 5mg.
[(E)-(5-nitrofuran-2-yl)methylideneamino](13C)urea (CAS 1217220-85-3) is a chemical compound with the molecular formula C6H6N4O4 and a molecular weight of 201.12 g/mol. IUPAC name: [(E)-(5-nitrofuran-2-yl)methylideneamino](13C)urea. InChIKey: IAIWVQXQOWNYOU-LTGGZAIESA-N.
| Molecular formula | C6H6N4O4 |
|---|---|
| Molecular weight | 201.12 g/mol |
| IUPAC name | [(E)-(5-nitrofuran-2-yl)methylideneamino](13C)urea |
| InChIKey | IAIWVQXQOWNYOU-LTGGZAIESA-N |
| SMILES | C1=C(OC(=C1)[N+](=O)[O-])/C=[15N]/[15NH][13C](=O)N |
Computed by PubChem (NCBI)