CAS 25864-34-0 is the registry number for 2-Amino-3,5-dinitro-6-methylpyridine, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
6-methyl-3,5-dinitropyridin-2-amine (CAS 25864-34-0) is a chemical compound with the molecular formula C6H6N4O4 and a molecular weight of 198.14 g/mol. IUPAC name: 6-methyl-3,5-dinitropyridin-2-amine. InChIKey: KWYALJWSYDOZON-UHFFFAOYSA-N.
| Molecular formula | C6H6N4O4 |
|---|---|
| Molecular weight | 198.14 g/mol |
| IUPAC name | 6-methyl-3,5-dinitropyridin-2-amine |
| InChIKey | KWYALJWSYDOZON-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])N |
Computed by PubChem (NCBI)