cas: 1589540-62-4 — see every product listed under this CAS number, including other names
4,6-Dichloro-2-methylnicotinaldehyde 95% (CAS 1589540-62-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A555642-100mg |
| cas | 1589540-62-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 654.06 Pln | |
| Ambeed | 250mg | 943.31 Pln | |
| Ambeed | 1g | 2211.56 Pln | |
| Ambeed | 5g | 7568.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A555642 |
4,6-dichloro-2-methylpyridine-3-carbaldehyde (CAS 1589540-62-4) is a chemical compound with the molecular formula C7H5Cl2NO and a molecular weight of 190.02 g/mol. IUPAC name: 4,6-dichloro-2-methylpyridine-3-carbaldehyde. InChIKey: XONDNTUBFCVNAZ-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO |
|---|---|
| Molecular weight | 190.02 g/mol |
| IUPAC name | 4,6-dichloro-2-methylpyridine-3-carbaldehyde |
| InChIKey | XONDNTUBFCVNAZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=N1)Cl)Cl)C=O |
Computed by PubChem (NCBI)