4,6-Dichloro-5-pyrimidinecarboxylic Acid, 97%, 97%
cas: 87600-98-4 — see every product listed under this CAS number, including other names
4,6-Dichloro-5-pyrimidinecarboxylic Acid, 97%, 97% (CAS 87600-98-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1147BL-1g |
| cas | 87600-98-4 |
| size | 1g |
| availability | 1000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 10g | 150.80 Pln | |
| Chemat | 25g | 285.20 Pln | |
| Chemat | 50g | 506.00 Pln | |
| Chemat | 100g | 942.80 Pln | |
| Chemat | 250g | 2267.60 Pln | |
| Chemat | 500g | 4545.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4,6-dichloropyrimidine-5-carboxylic acid (CAS 87600-98-4) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 4,6-dichloropyrimidine-5-carboxylic acid. InChIKey: KGBLYFGHJNGQBK-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 4,6-dichloropyrimidine-5-carboxylic acid |
| InChIKey | KGBLYFGHJNGQBK-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(C(=N1)Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)