cas: 74572-30-8 — see every product listed under this CAS number, including other names
4,6-Dichloroisoindolin-1-one, 98% (CAS 74572-30-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F633977-100MG |
| cas | 74572-30-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 221.81 Pln | |
| Fluorochem | 250mg | 450.90 Pln | |
| Fluorochem | 1g | 1632.78 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4,6-dichloro-2,3-dihydroisoindol-1-one (CAS 74572-30-8) is a chemical compound with the molecular formula C8H5Cl2NO and a molecular weight of 202.03 g/mol. IUPAC name: 4,6-dichloro-2,3-dihydroisoindol-1-one. InChIKey: QQNMVGPIDSWXTK-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NO |
|---|---|
| Molecular weight | 202.03 g/mol |
| IUPAC name | 4,6-dichloro-2,3-dihydroisoindol-1-one |
| InChIKey | QQNMVGPIDSWXTK-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2Cl)Cl)C(=O)N1 |
Computed by PubChem (NCBI)