CAS 21244-78-0 is the registry number for 2-(2,6-Dichlorophenoxy)acetonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(2,6-dichlorophenoxy)acetonitrile (CAS 21244-78-0) is a chemical compound with the molecular formula C8H5Cl2NO and a molecular weight of 202.03 g/mol. IUPAC name: 2-(2,6-dichlorophenoxy)acetonitrile. InChIKey: LVLKWYRHTDZICQ-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NO |
|---|---|
| Molecular weight | 202.03 g/mol |
| IUPAC name | 2-(2,6-dichlorophenoxy)acetonitrile |
| InChIKey | LVLKWYRHTDZICQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)OCC#N)Cl |
Computed by PubChem (NCBI)