cas: 73027-79-9 — see every product listed under this CAS number, including other names
4,6-Dichloronicotinic acid 98% (CAS 73027-79-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A149439-1g |
| cas | 73027-79-9 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 220.19 Pln | |
| Ambeed | 100g | 642.94 Pln | |
| Ambeed | 500g | 2918.00 Pln | |
| Ambeed | 1000g | 5766.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A149439 |
4,6-dichloropyridine-3-carboxylic acid (CAS 73027-79-9) is a chemical compound with the molecular formula C6H3Cl2NO2 and a molecular weight of 192.00 g/mol. IUPAC name: 4,6-dichloropyridine-3-carboxylic acid. InChIKey: ILMIEWNDXAKVNI-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO2 |
|---|---|
| Molecular weight | 192.00 g/mol |
| IUPAC name | 4,6-dichloropyridine-3-carboxylic acid |
| InChIKey | ILMIEWNDXAKVNI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)