cas: 92149-07-0 — see every product listed under this CAS number, including other names
4,7-Dimethoxy-1,10-phenanthroline, >95.0%(HPLC)(T) (CAS 92149-07-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D5870-1G |
| cas | 92149-07-0 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 683.83 Pln | |
| TCI | 5g | 2262.27 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(HPLC)(T) |
4,7-dimethoxy-1,10-phenanthroline (CAS 92149-07-0) is a chemical compound with the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. IUPAC name: 4,7-dimethoxy-1,10-phenanthroline. InChIKey: ZPGVCQYKXIQWTP-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 4,7-dimethoxy-1,10-phenanthroline |
| InChIKey | ZPGVCQYKXIQWTP-UHFFFAOYSA-N |
| SMILES | COC1=C2C=CC3=C(C=CN=C3C2=NC=C1)OC |
Computed by PubChem (NCBI)