cas: 92149-07-0 — see every product listed under this CAS number, including other names
4,7-Dimethoxy-1,10-phenanthroline, 95% (CAS 92149-07-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F077310-100MG |
| cas | 92149-07-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 81.24 Pln | |
| Fluorochem | 250mg | 91.65 Pln | |
| Fluorochem | 500mg | 112.48 Pln | |
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 2.5g | 200.99 Pln | |
| Fluorochem | 5g | 310.33 Pln | |
| Fluorochem | 10g | 560.24 Pln | |
| Fluorochem | 25g | 1091.30 Pln | |
| Fluorochem | 100g | 4183.96 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4,7-dimethoxy-1,10-phenanthroline (CAS 92149-07-0) is a chemical compound with the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. IUPAC name: 4,7-dimethoxy-1,10-phenanthroline. InChIKey: ZPGVCQYKXIQWTP-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 4,7-dimethoxy-1,10-phenanthroline |
| InChIKey | ZPGVCQYKXIQWTP-UHFFFAOYSA-N |
| SMILES | COC1=C2C=CC3=C(C=CN=C3C2=NC=C1)OC |
Computed by PubChem (NCBI)