cas: 92149-07-0 — see every product listed under this CAS number, including other names
4,7-Dimethoxy-1,10-phenanthroline, 97% (CAS 92149-07-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250MG. Offered by: Thermo Scientific (Acros), Sigma-Aldrich.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 433780010 |
| cas | 92149-07-0 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 1358.61 Pln | |
| Thermo Scientific (Acros) | 250MG | 489.99 Pln | |
| Sigma-Aldrich | 1G | 1460.00 Pln | |
| Sigma-Aldrich | 250MG | 619.00 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
4,7-dimethoxy-1,10-phenanthroline (CAS 92149-07-0) is a chemical compound with the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. IUPAC name: 4,7-dimethoxy-1,10-phenanthroline. InChIKey: ZPGVCQYKXIQWTP-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 4,7-dimethoxy-1,10-phenanthroline |
| InChIKey | ZPGVCQYKXIQWTP-UHFFFAOYSA-N |
| SMILES | COC1=C2C=CC3=C(C=CN=C3C2=NC=C1)OC |
Computed by PubChem (NCBI)