cas: 3248-05-3 — see every product listed under this CAS number, including other names
4,7-Dimethyl-1,10-phenanthroline, 95% (CAS 3248-05-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F226295-100MG |
| cas | 3248-05-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 107.27 Pln | |
| Fluorochem | 250mg | 138.51 Pln | |
| Fluorochem | 1g | 294.71 Pln | |
| Fluorochem | 5g | 981.96 Pln | |
| Fluorochem | 10g | 1830.62 Pln | |
| Fluorochem | 25g | 4225.61 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4,7-dimethyl-1,10-phenanthroline (CAS 3248-05-3) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: 4,7-dimethyl-1,10-phenanthroline. InChIKey: JIVLDFFWTQYGSR-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 4,7-dimethyl-1,10-phenanthroline |
| InChIKey | JIVLDFFWTQYGSR-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC3=C(C=CN=C3C2=NC=C1)C |
Computed by PubChem (NCBI)