cas: 371764-64-6 — see every product listed under this CAS number, including other names
4–Quinolineboronic acid (contains varying amounts of Anhydride) (CAS 371764-64-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD20546-1g |
| cas | 371764-64-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 770.22 Pln | |
| GLPBio | 250mg | 545.55 Pln | |
| GLPBio | 25g | 5909.41 Pln | |
| GLPBio | 5g | 1860.77 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
Quinolin-4-ylboronic acid (CAS 371764-64-6) is a chemical compound with the molecular formula C9H8BNO2 and a molecular weight of 172.98 g/mol. IUPAC name: quinolin-4-ylboronic acid. InChIKey: KATIRQRAVXTBNY-UHFFFAOYSA-N.
| Molecular formula | C9H8BNO2 |
|---|---|
| Molecular weight | 172.98 g/mol |
| IUPAC name | quinolin-4-ylboronic acid |
| InChIKey | KATIRQRAVXTBNY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=NC2=CC=CC=C12)(O)O |
Computed by PubChem (NCBI)