cas: 371764-64-6 — see every product listed under this CAS number, including other names
Quinoline-4-boronic acid, 98%, 98% (CAS 371764-64-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1146K8-100mg |
| cas | 371764-64-6 |
| size | 100mg |
| availability | 250g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 640.40 Pln | |
| Chemat | 10g | 1053.20 Pln | |
| Chemat | 25g | 2128.40 Pln | |
| Chemat | 50g | 3506.00 Pln | |
| Chemat | 100g | 6678.80 Pln | |
| Chemat | 250g | 8915.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Quinolin-4-ylboronic acid (CAS 371764-64-6) is a chemical compound with the molecular formula C9H8BNO2 and a molecular weight of 172.98 g/mol. IUPAC name: quinolin-4-ylboronic acid. InChIKey: KATIRQRAVXTBNY-UHFFFAOYSA-N.
| Molecular formula | C9H8BNO2 |
|---|---|
| Molecular weight | 172.98 g/mol |
| IUPAC name | quinolin-4-ylboronic acid |
| InChIKey | KATIRQRAVXTBNY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=NC2=CC=CC=C12)(O)O |
Computed by PubChem (NCBI)