cas: 128276-50-6 — see every product listed under this CAS number, including other names
4,6-Dimethoxypyrimidine-2-carboxylic acid, 97%, 97% (CAS 128276-50-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111XXS-250mg |
| cas | 128276-50-6 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 314.00 Pln | |
| Chemat | 5g | 707.60 Pln | |
| Chemat | 10g | 1221.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4,6-dimethoxypyrimidine-2-carboxylic acid (CAS 128276-50-6) is a chemical compound with the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. IUPAC name: 4,6-dimethoxypyrimidine-2-carboxylic acid. InChIKey: PRXXMEMJCXTHTP-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 4,6-dimethoxypyrimidine-2-carboxylic acid |
| InChIKey | PRXXMEMJCXTHTP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=NC(=N1)C(=O)O)OC |
Computed by PubChem (NCBI)