Products 1384543-10-5
CAS 1384543-10-5 is the registry number for 4-(1H-Imidazol-4-yl)-1-methyl-1H-pyrazole dihydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-(1H-imidazol-5-yl)-1-methylpyrazole;dihydrochloride (CAS 1384543-10-5) is a chemical compound with the molecular formula C7H10Cl2N4 and a molecular weight of 221.08 g/mol. IUPAC name: 4-(1H-imidazol-5-yl)-1-methylpyrazole;dihydrochloride. InChIKey: UDOXWJMNXVQSQK-UHFFFAOYSA-N.
| Molecular formula | C7H10Cl2N4 |
|---|---|
| Molecular weight | 221.08 g/mol |
| IUPAC name | 4-(1H-imidazol-5-yl)-1-methylpyrazole;dihydrochloride |
| InChIKey | UDOXWJMNXVQSQK-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=CN=CN2.Cl.Cl |
Computed by PubChem (NCBI)