CAS 1352305-27-1 appears in our catalog under these names: 6-Aminomethyl-imidazo[1,2-a]pyrazine dihydrochloride, 95%, Imidazo(1,2–a)pyrazin–6–ylmethanamine dihydrochloride, 6-AMINOMETHYL-IMIDAZO[1,2-A]PYRAZINE 2HCL, 97%, 97%, 6-AMINOMETHYL-IMIDAZO[1,2-A]PYRAZINE 2HCL, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 25mg, 100mg.
Imidazo[1,2-a]pyrazin-6-ylmethanamine;dihydrochloride (CAS 1352305-27-1) is a chemical compound with the molecular formula C7H10Cl2N4 and a molecular weight of 221.08 g/mol. IUPAC name: imidazo[1,2-a]pyrazin-6-ylmethanamine;dihydrochloride. InChIKey: WMQSEFDZOZYILP-UHFFFAOYSA-N.
| Molecular formula | C7H10Cl2N4 |
|---|---|
| Molecular weight | 221.08 g/mol |
| IUPAC name | imidazo[1,2-a]pyrazin-6-ylmethanamine;dihydrochloride |
| InChIKey | WMQSEFDZOZYILP-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(N=CC2=N1)CN.Cl.Cl |
Computed by PubChem (NCBI)