Products 2102412-95-1

CAS 2102412-95-1 is the registry number for 1-(3H-Imidazo[4,5-b]pyridin-7-yl)methanamine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

1H-imidazo[4,5-b]pyridin-7-ylmethanamine;dihydrochloride (CAS 2102412-95-1) is a chemical compound with the molecular formula C7H10Cl2N4 and a molecular weight of 221.08 g/mol. IUPAC name: 1H-imidazo[4,5-b]pyridin-7-ylmethanamine;dihydrochloride. InChIKey: AGYRPPMYQMJOCP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10Cl2N4
Molecular weight221.08 g/mol
IUPAC name1H-imidazo[4,5-b]pyridin-7-ylmethanamine;dihydrochloride
InChIKeyAGYRPPMYQMJOCP-UHFFFAOYSA-N
SMILESC1=CN=C2C(=C1CN)NC=N2.Cl.Cl

Computed by PubChem (NCBI)