CAS 1992996-09-4 appears in our catalog under these names: (Imidazo[1,2-a]pyrazin-3-ylmethyl)amine dihydrochloride, 95%, (IMidazo(1,2-a)pyrazin-3-ylmethyl)amine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
Imidazo[1,2-a]pyrazin-3-ylmethanamine;dihydrochloride (CAS 1992996-09-4) is a chemical compound with the molecular formula C7H10Cl2N4 and a molecular weight of 221.08 g/mol. IUPAC name: imidazo[1,2-a]pyrazin-3-ylmethanamine;dihydrochloride. InChIKey: UOHHVHLFGLZXHM-UHFFFAOYSA-N.
| Molecular formula | C7H10Cl2N4 |
|---|---|
| Molecular weight | 221.08 g/mol |
| IUPAC name | imidazo[1,2-a]pyrazin-3-ylmethanamine;dihydrochloride |
| InChIKey | UOHHVHLFGLZXHM-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=CN=C2C=N1)CN.Cl.Cl |
Computed by PubChem (NCBI)