CAS 90000-54-7 appears in our catalog under these names: 5,6-Diaminobenzimidazole Dihydrochloride, 1H–Benzo(d)imidazole–5,6–diamine dihydrochloride, 1H-Benzo[d]imidazole-5,6-diamine dihydrochloride 97%, 5,6-Diaminobenzimidazole Dihydrochloride, 97%, 97%, 1H-Benzo[d]imidazole-5,6-diamine dihydrochloride, 97%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 25mg, 50mg, 1g, 250mg, 10mg, 5mg, 5g.
1H-benzimidazole-5,6-diamine;dihydrochloride (CAS 90000-54-7) is a chemical compound with the molecular formula C7H10Cl2N4 and a molecular weight of 221.08 g/mol. IUPAC name: 1H-benzimidazole-5,6-diamine;dihydrochloride. InChIKey: XOEWEVKPPVSJDW-UHFFFAOYSA-N.
| Molecular formula | C7H10Cl2N4 |
|---|---|
| Molecular weight | 221.08 g/mol |
| IUPAC name | 1H-benzimidazole-5,6-diamine;dihydrochloride |
| InChIKey | XOEWEVKPPVSJDW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC2=C1NC=N2)N)N.Cl.Cl |
Computed by PubChem (NCBI)