CAS 2169998-44-9 appears in our catalog under these names: (1H-Pyrazolo[3,4-b]pyridin-3-ylmethyl)amine dihydrochloride, 95%, (1H-Pyrazolo(3,4-b)pyridin-3-ylmethyl)amine dihydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 10g, 5g, 250mg, 2,5g.
2H-pyrazolo[3,4-b]pyridin-3-ylmethanamine;dihydrochloride (CAS 2169998-44-9) is a chemical compound with the molecular formula C7H10Cl2N4 and a molecular weight of 221.08 g/mol. IUPAC name: 2H-pyrazolo[3,4-b]pyridin-3-ylmethanamine;dihydrochloride. InChIKey: WNNMOQLDBPOIRB-UHFFFAOYSA-N.
| Molecular formula | C7H10Cl2N4 |
|---|---|
| Molecular weight | 221.08 g/mol |
| IUPAC name | 2H-pyrazolo[3,4-b]pyridin-3-ylmethanamine;dihydrochloride |
| InChIKey | WNNMOQLDBPOIRB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NN=C2N=C1)CN.Cl.Cl |
Computed by PubChem (NCBI)