CAS 91981-60-1 appears in our catalog under these names: ([1,2,4]Triazolo[4,3-a]pyridin-3-ylmethyl)amine dihydrochloride, 95%, (1,2,4)Triazolo(4,3-a)pyridin-3-ylmethanamine dihydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
[1,2,4]triazolo[4,3-a]pyridin-3-ylmethanamine;dihydrochloride (CAS 91981-60-1) is a chemical compound with the molecular formula C7H10Cl2N4 and a molecular weight of 221.08 g/mol. IUPAC name: [1,2,4]triazolo[4,3-a]pyridin-3-ylmethanamine;dihydrochloride. InChIKey: PJCXRTGEVVDRPB-UHFFFAOYSA-N.
| Molecular formula | C7H10Cl2N4 |
|---|---|
| Molecular weight | 221.08 g/mol |
| IUPAC name | [1,2,4]triazolo[4,3-a]pyridin-3-ylmethanamine;dihydrochloride |
| InChIKey | PJCXRTGEVVDRPB-UHFFFAOYSA-N |
| SMILES | C1=CC2=NN=C(N2C=C1)CN.Cl.Cl |
Computed by PubChem (NCBI)