cas: 247225-31-6 — see every product listed under this CAS number, including other names
4-(2,4-Dimethylphenyl)thiazol-2-ylamine (CAS 247225-31-6) is a chemical reagent available from Chemat. Available pack sizes: 2g, 5g, 500mg, 1g, 2.5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014140-2G |
| cas | 247225-31-6 |
| size | 2g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 2g | 1226.67 Pln | |
| Fluorochem | 5g | 2559.53 Pln | |
| Fluorochem | 500mg | 424.87 Pln | |
| Fluorochem | 1g | 674.78 Pln | |
| Fluorochem | 2.5g | 1299.56 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | no data |
4-(2,4-dimethylphenyl)-1,3-thiazol-2-amine (CAS 247225-31-6) is a chemical compound with the molecular formula C11H12N2S and a molecular weight of 204.29 g/mol. IUPAC name: 4-(2,4-dimethylphenyl)-1,3-thiazol-2-amine. InChIKey: OJXMEMYRDCFPHW-UHFFFAOYSA-N.
| Molecular formula | C11H12N2S |
|---|---|
| Molecular weight | 204.29 g/mol |
| IUPAC name | 4-(2,4-dimethylphenyl)-1,3-thiazol-2-amine |
| InChIKey | OJXMEMYRDCFPHW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=CSC(=N2)N)C |
Computed by PubChem (NCBI)