cas: 247225-31-6 — see every product listed under this CAS number, including other names
4-(2,4-Dimethylphenyl)thiazol-2-amine 95% (CAS 247225-31-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A137418-100mg |
| cas | 247225-31-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 192.38 Pln | |
| Ambeed | 250mg | 286.94 Pln | |
| Ambeed | 1g | 642.94 Pln | |
| Ambeed | 5g | 2400.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A137418 |
4-(2,4-dimethylphenyl)-1,3-thiazol-2-amine (CAS 247225-31-6) is a chemical compound with the molecular formula C11H12N2S and a molecular weight of 204.29 g/mol. IUPAC name: 4-(2,4-dimethylphenyl)-1,3-thiazol-2-amine. InChIKey: OJXMEMYRDCFPHW-UHFFFAOYSA-N.
| Molecular formula | C11H12N2S |
|---|---|
| Molecular weight | 204.29 g/mol |
| IUPAC name | 4-(2,4-dimethylphenyl)-1,3-thiazol-2-amine |
| InChIKey | OJXMEMYRDCFPHW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=CSC(=N2)N)C |
Computed by PubChem (NCBI)