cas: 247225-31-6 — see every product listed under this CAS number, including other names
4-(2,4-dimethylphenyl)-1,3-thiazol-2-amine, 95%, 95% (CAS 247225-31-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113P8V-100mg |
| cas | 247225-31-6 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 486.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(2,4-dimethylphenyl)-1,3-thiazol-2-amine (CAS 247225-31-6) is a chemical compound with the molecular formula C11H12N2S and a molecular weight of 204.29 g/mol. IUPAC name: 4-(2,4-dimethylphenyl)-1,3-thiazol-2-amine. InChIKey: OJXMEMYRDCFPHW-UHFFFAOYSA-N.
| Molecular formula | C11H12N2S |
|---|---|
| Molecular weight | 204.29 g/mol |
| IUPAC name | 4-(2,4-dimethylphenyl)-1,3-thiazol-2-amine |
| InChIKey | OJXMEMYRDCFPHW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=CSC(=N2)N)C |
Computed by PubChem (NCBI)