cas: 222987-21-5 — see every product listed under this CAS number, including other names
4-(2-Aminopyrimidin-5-yl)benzoic acid, 98% (CAS 222987-21-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 100mg, 250mg. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QA-5064-10g |
| cas | 222987-21-5 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 100g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 294.71 Pln | |
| Fluorochem | 5g | 841.39 Pln | |
| Fluorochem | 10g | 1627.57 Pln | |
| Fluorochem | 25g | 3975.70 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4-(2-aminopyrimidin-5-yl)benzoic acid (CAS 222987-21-5) is a chemical compound with the molecular formula C11H9N3O2 and a molecular weight of 215.21 g/mol. IUPAC name: 4-(2-aminopyrimidin-5-yl)benzoic acid. InChIKey: AHHQGKDKFINLBL-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O2 |
|---|---|
| Molecular weight | 215.21 g/mol |
| IUPAC name | 4-(2-aminopyrimidin-5-yl)benzoic acid |
| InChIKey | AHHQGKDKFINLBL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=C(N=C2)N)C(=O)O |
Computed by PubChem (NCBI)