CAS 19675-63-9 appears in our catalog under these names: 4–(2–Carboxyvinyl)benzoic acid, 4-Carboxycinnamic acid, 4-(2-Carboxyvinyl)benzoic acid, 95% (E), 95% (E), 4-Carboxycinnamic acid, 97%, 4-(2-Carboxyvinyl)benzoic acid, 95% (E). Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 10g, 50g, 100g, 250g, 250mg, 1g.
4-(2-carboxyethenyl)benzoic acid (CAS 19675-63-9) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: 4-(2-carboxyethenyl)benzoic acid. InChIKey: HAEJSGLKJYIYTB-UHFFFAOYSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 4-(2-carboxyethenyl)benzoic acid |
| InChIKey | HAEJSGLKJYIYTB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)