Products 216431-29-7
CAS 216431-29-7 appears in our catalog under these names: 2-Vinylterephthalic acid, 95%, 2–Vinylterephthalic acid, 2-Vinylterephthalic acid 97%, 2-Ethenyl-1,4-benzenedicarboxylic acid, 97%, 97%, 2-Vinylterephthalic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 5g, 1g, 10g.
2-ethenylterephthalic acid (CAS 216431-29-7) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: 2-ethenylterephthalic acid. InChIKey: CFCMNKJCKDXHHO-UHFFFAOYSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 2-ethenylterephthalic acid |
| InChIKey | CFCMNKJCKDXHHO-UHFFFAOYSA-N |
| SMILES | C=CC1=C(C=CC(=C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)