CAS 5817-92-5 appears in our catalog under these names: 2,4-Dioxo-4-phenylbutanoic acid, 98%, 2,4-Dioxo-4-phenylbutanoic acid, >95% (HPLC), 2,4-Dioxo-4-phenylbutanoic acid, 2,4-DIOXO-4-PHENYLBUTANOIC ACID, 98%, 98%. Offered by: Combi-blocks, TRC, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 100mg, 250mg, 500mg, 1000mg.
2,4-dioxo-4-phenylbutanoic acid (CAS 5817-92-5) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: 2,4-dioxo-4-phenylbutanoic acid. InChIKey: JGKFWCXVYCDKDU-UHFFFAOYSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 2,4-dioxo-4-phenylbutanoic acid |
| InChIKey | JGKFWCXVYCDKDU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CC(=O)C(=O)O |
Computed by PubChem (NCBI)