CAS 287118-44-9 appears in our catalog under these names: (Z)-3-(1,3-Benzodioxol-4-yl)prop-2-enoic acid, 95%, 2,3-Methylenedioxycinnamic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g, 2g.
(E)-3-(1,3-benzodioxol-4-yl)prop-2-enoic acid (CAS 287118-44-9) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: (E)-3-(1,3-benzodioxol-4-yl)prop-2-enoic acid. InChIKey: NWSIULATLGKZGF-SNAWJCMRSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | (E)-3-(1,3-benzodioxol-4-yl)prop-2-enoic acid |
| InChIKey | NWSIULATLGKZGF-SNAWJCMRSA-N |
| SMILES | C1OC2=CC=CC(=C2O1)/C=C/C(=O)O |
Computed by PubChem (NCBI)