CAS 131922-15-1 is the registry number for 2-Benzofuranylglyoxal hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-(1-benzofuran-2-yl)-2-oxoacetaldehyde;hydrate (CAS 131922-15-1) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: 2-(1-benzofuran-2-yl)-2-oxoacetaldehyde;hydrate. InChIKey: JVZHUDOMODCNLO-UHFFFAOYSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 2-(1-benzofuran-2-yl)-2-oxoacetaldehyde;hydrate |
| InChIKey | JVZHUDOMODCNLO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)C(=O)C=O.O |
Computed by PubChem (NCBI)