Products 25974-99-6
CAS 25974-99-6 appears in our catalog under these names: 3-Carboxycinnamic acid, 95%, 3-Carboxycinnamic acid, 3-Carboxycinnamic acid, min. 90 %, 50 g, 3-Carboxycinnamic acid, min. 90 %, 100 g, 3-Carboxycinnamic acid, min. 90 %, 250 g. Offered by: Combi-blocks, Biosynth, Roth. Available pack sizes: 1g, 100g, 25g, 5g, 50g, 250g.
3-[(E)-2-carboxyethenyl]benzoic acid (CAS 25974-99-6) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: 3-[(E)-2-carboxyethenyl]benzoic acid. InChIKey: KLWPBEWWHJTYDC-SNAWJCMRSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 3-[(E)-2-carboxyethenyl]benzoic acid |
| InChIKey | KLWPBEWWHJTYDC-SNAWJCMRSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)/C=C/C(=O)O |
Computed by PubChem (NCBI)