Products 612-40-8
CAS 612-40-8 appears in our catalog under these names: 2-carboxycinnamic acid, 95%, 2-Carboxycinnamic acid/ 99%, 2-Carboxycinnamic acid, predominantly trans, 97% , 2-Carboxycinnamic acid, ≥97%, ≥97%, 2-Carboxycinnamic acid (predominantly trans), 97%. Offered by: Combi-blocks, Chemat, Thermo Scientific (Alfa Aesar), Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g, 50g.
2-(2-carboxyethenyl)benzoic acid (CAS 612-40-8) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: 2-(2-carboxyethenyl)benzoic acid. InChIKey: SCWPNMHQRGNQHH-UHFFFAOYSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 2-(2-carboxyethenyl)benzoic acid |
| InChIKey | SCWPNMHQRGNQHH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)