cas: 1562-93-2 — see every product listed under this CAS number, including other names
4-(2-Phenyldiazenyl)benzoic acid, 95%, 95% (CAS 1562-93-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 100mg, 250mg, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112OLA-1g |
| cas | 1562-93-2 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 213.20 Pln | |
| Chemat | 25g | 654.80 Pln | |
| Chemat | 100g | 2109.20 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 10g | 366.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-phenyldiazenylbenzoic acid (CAS 1562-93-2) is a chemical compound with the molecular formula C13H10N2O2 and a molecular weight of 226.23 g/mol. IUPAC name: 4-phenyldiazenylbenzoic acid. InChIKey: CSPTZWQFHBVOLO-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O2 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 4-phenyldiazenylbenzoic acid |
| InChIKey | CSPTZWQFHBVOLO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=NC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)