cas: 1562-93-2 — see every product listed under this CAS number, including other names
4-(Phenyldiazenyl)benzoic acid, 98.0% (CAS 1562-93-2) is a chemical reagent available from Chemat. Available pack sizes: 10mM/1mL, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W106234-10mM/1mL |
| cas | 1562-93-2 |
| size | 10mM/1mL |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 277.90 Pln | |
| MedChemExpress | 1 g | 263.96 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
4-phenyldiazenylbenzoic acid (CAS 1562-93-2) is a chemical compound with the molecular formula C13H10N2O2 and a molecular weight of 226.23 g/mol. IUPAC name: 4-phenyldiazenylbenzoic acid. InChIKey: CSPTZWQFHBVOLO-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O2 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 4-phenyldiazenylbenzoic acid |
| InChIKey | CSPTZWQFHBVOLO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=NC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)