cas: 1562-93-2 — see every product listed under this CAS number, including other names
4-(Phenyldiazenyl)benzoic acid, 95% (CAS 1562-93-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F987434-5G |
| cas | 1562-93-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 508.17 Pln | |
| Fluorochem | 10g | 966.34 Pln | |
| Fluorochem | 25g | 1424.52 Pln | |
| Fluorochem | 100g | 2814.65 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-phenyldiazenylbenzoic acid (CAS 1562-93-2) is a chemical compound with the molecular formula C13H10N2O2 and a molecular weight of 226.23 g/mol. IUPAC name: 4-phenyldiazenylbenzoic acid. InChIKey: CSPTZWQFHBVOLO-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O2 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 4-phenyldiazenylbenzoic acid |
| InChIKey | CSPTZWQFHBVOLO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=NC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)