cas: 1562-93-2 — see every product listed under this CAS number, including other names
4-(Phenylazo)benzoic Acid, >98.0%(T) (CAS 1562-93-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | P0143-1G |
| cas | 1562-93-2 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 192.10 Pln | |
| TCI | 5g | 555.98 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
4-phenyldiazenylbenzoic acid (CAS 1562-93-2) is a chemical compound with the molecular formula C13H10N2O2 and a molecular weight of 226.23 g/mol. IUPAC name: 4-phenyldiazenylbenzoic acid. InChIKey: CSPTZWQFHBVOLO-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O2 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 4-phenyldiazenylbenzoic acid |
| InChIKey | CSPTZWQFHBVOLO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=NC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)