CAS 22607-31-4 appears in our catalog under these names: 4-(2H-Benzo[d][1,2,3]triazol-2-yl)benzene-1,3-diol, 95+%, 95+%, 4-(2H-BENZO[D][1,2,3]TRIAZOL-2-YL)BENZENE-1,3-DIOL, 95+%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 25g.
4-(benzotriazol-2-yl)benzene-1,3-diol (CAS 22607-31-4) is a chemical compound with the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. IUPAC name: 4-(benzotriazol-2-yl)benzene-1,3-diol. InChIKey: LEBRCVXHIFZXEM-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O2 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | 4-(benzotriazol-2-yl)benzene-1,3-diol |
| InChIKey | LEBRCVXHIFZXEM-UHFFFAOYSA-N |
| SMILES | C1=CC2=NN(N=C2C=C1)C3=C(C=C(C=C3)O)O |
Computed by PubChem (NCBI)