CAS 51843-31-3 appears in our catalog under these names: 5-(1H-Indol-3-yl)-1H-pyrazole-3-carboxylic acid, 5-(1H-Indol-3-yl)-1h-pyrazole-3-carboxylic acid, 95%, 5-(1H-Indol-3-yl)-1H-pyrazole-3-carboxylic acid, 97%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 0,25g, 5g, 250mg, 1g.
3-(1H-indol-3-yl)-1H-pyrazole-5-carboxylic acid (CAS 51843-31-3) is a chemical compound with the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. IUPAC name: 3-(1H-indol-3-yl)-1H-pyrazole-5-carboxylic acid. InChIKey: LWCOJZLPIRKQIZ-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O2 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | 3-(1H-indol-3-yl)-1H-pyrazole-5-carboxylic acid |
| InChIKey | LWCOJZLPIRKQIZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C3=NNC(=C3)C(=O)O |
Computed by PubChem (NCBI)