CAS 1440535-46-5 is the registry number for 1-(1-Methyl-1h-indazol-3-yl)-1h-pyrrole-2,5-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(1-methylindazol-3-yl)pyrrole-2,5-dione (CAS 1440535-46-5) is a chemical compound with the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. IUPAC name: 1-(1-methylindazol-3-yl)pyrrole-2,5-dione. InChIKey: WPOOPAJESSJFEZ-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O2 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | 1-(1-methylindazol-3-yl)pyrrole-2,5-dione |
| InChIKey | WPOOPAJESSJFEZ-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C(=N1)N3C(=O)C=CC3=O |
Computed by PubChem (NCBI)