CAS 36980-88-8 is the registry number for 3-Methyl-2,4-dioxo-1-phenyl-1,2,3,4-tetrahydropyrimidine-5-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-methyl-2,4-dioxo-1-phenylpyrimidine-5-carbonitrile (CAS 36980-88-8) is a chemical compound with the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. IUPAC name: 3-methyl-2,4-dioxo-1-phenylpyrimidine-5-carbonitrile. InChIKey: MIITVIRUHNKIRT-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O2 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | 3-methyl-2,4-dioxo-1-phenylpyrimidine-5-carbonitrile |
| InChIKey | MIITVIRUHNKIRT-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=CN(C1=O)C2=CC=CC=C2)C#N |
Computed by PubChem (NCBI)