Products 337502-10-0
CAS 337502-10-0 is the registry number for 4-[5-(2-Furyl)-1,3,4-oxadiazol-2-yl]aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]aniline (CAS 337502-10-0) is a chemical compound with the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. IUPAC name: 4-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]aniline. InChIKey: GFVJJNIIMSPNRZ-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O2 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | 4-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]aniline |
| InChIKey | GFVJJNIIMSPNRZ-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=NN=C(O2)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)