CAS 17334-68-8 appears in our catalog under these names: 3-Methyl-4-phenyl-6h,7h-[1,2]oxazolo[3,4-d]pyridazin-7-one, 95%, 3-Methyl-4-phenylisoxazolo(3,4-d)pyridazin-7(6H)-one, 98%, 3-Methyl-4-phenyl-6H,7H-(1,2)oxazolo(3,4-d)pyridazin-7-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
3-methyl-4-phenyl-6H-[1,2]oxazolo[3,4-d]pyridazin-7-one (CAS 17334-68-8) is a chemical compound with the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. IUPAC name: 3-methyl-4-phenyl-6H-[1,2]oxazolo[3,4-d]pyridazin-7-one. InChIKey: YUQZAUWIHXYWKC-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O2 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | 3-methyl-4-phenyl-6H-[1,2]oxazolo[3,4-d]pyridazin-7-one |
| InChIKey | YUQZAUWIHXYWKC-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=NNC(=O)C2=NO1)C3=CC=CC=C3 |
Computed by PubChem (NCBI)