Products 34771-39-6
CAS 34771-39-6 appears in our catalog under these names: 6-Phenyl-5h-pyrrolo[3,2-d]pyrimidine-2,4-diol, 95%, 6-Phenyl-5H-pyrrolo(3,2-d)pyrimidine-2,4-diol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 100mg.
6-phenyl-1,5-dihydropyrrolo[3,2-d]pyrimidine-2,4-dione (CAS 34771-39-6) is a chemical compound with the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. IUPAC name: 6-phenyl-1,5-dihydropyrrolo[3,2-d]pyrimidine-2,4-dione. InChIKey: SHQYZHCVGVXICO-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O2 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | 6-phenyl-1,5-dihydropyrrolo[3,2-d]pyrimidine-2,4-dione |
| InChIKey | SHQYZHCVGVXICO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(N2)C(=O)NC(=O)N3 |
Computed by PubChem (NCBI)