cas: 139503-12-1 — see every product listed under this CAS number, including other names
4-(3,5-Difluorophenyl)tetrahydro-2H-pyran-4-ol, 98%, 98% (CAS 139503-12-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112B68-100mg |
| cas | 139503-12-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 1g | 501.20 Pln | |
| Chemat | 5g | 1370.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(3,5-difluorophenyl)oxan-4-ol (CAS 139503-12-1) is a chemical compound with the molecular formula C11H12F2O2 and a molecular weight of 214.21 g/mol. IUPAC name: 4-(3,5-difluorophenyl)oxan-4-ol. InChIKey: IAOXCRBWNOMXEF-UHFFFAOYSA-N.
| Molecular formula | C11H12F2O2 |
|---|---|
| Molecular weight | 214.21 g/mol |
| IUPAC name | 4-(3,5-difluorophenyl)oxan-4-ol |
| InChIKey | IAOXCRBWNOMXEF-UHFFFAOYSA-N |
| SMILES | C1COCCC1(C2=CC(=CC(=C2)F)F)O |
Computed by PubChem (NCBI)