Products 1409512-84-0

CAS 1409512-84-0 is the registry number for tert-Butyl 2,5-difluorobenzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl 2,5-difluorobenzoate (CAS 1409512-84-0) is a chemical compound with the molecular formula C11H12F2O2 and a molecular weight of 214.21 g/mol. IUPAC name: tert-butyl 2,5-difluorobenzoate. InChIKey: MFHQVNQGHHWQSU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12F2O2
Molecular weight214.21 g/mol
IUPAC nametert-butyl 2,5-difluorobenzoate
InChIKeyMFHQVNQGHHWQSU-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C1=C(C=CC(=C1)F)F

Computed by PubChem (NCBI)