CAS 1409512-84-0 is the registry number for tert-Butyl 2,5-difluorobenzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Tert-butyl 2,5-difluorobenzoate (CAS 1409512-84-0) is a chemical compound with the molecular formula C11H12F2O2 and a molecular weight of 214.21 g/mol. IUPAC name: tert-butyl 2,5-difluorobenzoate. InChIKey: MFHQVNQGHHWQSU-UHFFFAOYSA-N.
| Molecular formula | C11H12F2O2 |
|---|---|
| Molecular weight | 214.21 g/mol |
| IUPAC name | tert-butyl 2,5-difluorobenzoate |
| InChIKey | MFHQVNQGHHWQSU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=CC(=C1)F)F |
Computed by PubChem (NCBI)