CAS 1881320-85-9 is the registry number for 4-(cyclopentyloxy)-2,3-difluorophenol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-cyclopentyloxy-2,3-difluorophenol (CAS 1881320-85-9) is a chemical compound with the molecular formula C11H12F2O2 and a molecular weight of 214.21 g/mol. IUPAC name: 4-cyclopentyloxy-2,3-difluorophenol. InChIKey: YCJUKVONSGZJGR-UHFFFAOYSA-N.
| Molecular formula | C11H12F2O2 |
|---|---|
| Molecular weight | 214.21 g/mol |
| IUPAC name | 4-cyclopentyloxy-2,3-difluorophenol |
| InChIKey | YCJUKVONSGZJGR-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)OC2=C(C(=C(C=C2)O)F)F |
Computed by PubChem (NCBI)